C13H9N5O4S — CID 121086709
N-(6-nitro-1,3-benzothiazol-2-yl)-2-pyrimidin-2-yloxyacetamide (PubChem CID 121086709) has the molecular formula C13H9N5O4S and a molecular weight of 331.31 g/mol. Its IUPAC name is N-(6-nitro-1,3-benzothiazol-2-yl)-2-pyrimidin-2-yloxyacetamide.
| Compound Name | N-(6-nitro-1,3-benzothiazol-2-yl)-2-pyrimidin-2-yloxyacetamide |
|---|---|
| PubChem CID | 121086709 |
| Molecular Formula | C13H9N5O4S |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-(6-nitro-1,3-benzothiazol-2-yl)-2-pyrimidin-2-yloxyacetamide |
| SMILES | O=C(COc1ncccn1)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C13H9N5O4S/c19-11(7-22-12-14-4-1-5-15-12)17-13-16-9-3-2-8(18(20)21)6-10(9)23-13/h1-6H,7H2,(H,16,17,19) |
| InChIKey | JWCFLHFMRZAYKJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|