C17H14N4O5S — CID 23824530
[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-(methylamino)benzoate (PubChem CID 23824530) has the molecular formula C17H14N4O5S and a molecular weight of 386.39 g/mol. Its IUPAC name is [2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-(methylamino)benzoate.
| Compound Name | [2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-(methylamino)benzoate |
|---|---|
| PubChem CID | 23824530 |
| Molecular Formula | C17H14N4O5S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | [2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)OCC(=O)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C17H14N4O5S/c1-18-12-5-3-2-4-11(12)16(23)26-9-15(22)20-17-19-13-7-6-10(21(24)25)8-14(13)27-17/h2-8,18H,9H2,1H3,(H,19,20,22) |
| InChIKey | LQLXXCIMEHUDIC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|