C24H20N2O4S — CID 23847548
[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-benzylbenzoate (PubChem CID 23847548) has the molecular formula C24H20N2O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-benzylbenzoate.
| Compound Name | [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-benzylbenzoate |
|---|---|
| PubChem CID | 23847548 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-benzylbenzoate |
| SMILES | COc1ccc2nc(NC(=O)COC(=O)c3ccccc3Cc3ccccc3)sc2c1 |
| InChI | InChI=1S/C24H20N2O4S/c1-29-18-11-12-20-21(14-18)31-24(25-20)26-22(27)15-30-23(28)19-10-6-5-9-17(19)13-16-7-3-2-4-8-16/h2-12,14H,13,15H2,1H3,(H,25,26,27) |
| InChIKey | XJBXYNBEFBPQMI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |