C16H11N3O6S — CID 4843798
[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-(furan-2-yl)prop-2-enoate (PubChem CID 4843798) has the molecular formula C16H11N3O6S and a molecular weight of 373.35 g/mol. Its IUPAC name is [2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4843798 |
| Molecular Formula | C16H11N3O6S |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | [2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 3-(furan-2-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccco1)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C16H11N3O6S/c20-14(9-25-15(21)6-4-11-2-1-7-24-11)18-16-17-12-5-3-10(19(22)23)8-13(12)26-16/h1-8H,9H2,(H,17,18,20) |
| InChIKey | PGENCDOCGQKBTC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|