C20H18N4O8S2 — CID 23941454
[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-hydroxy-5-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 23941454) has the molecular formula C20H18N4O8S2 and a molecular weight of 506.52 g/mol. Its IUPAC name is [2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-hydroxy-5-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-hydroxy-5-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 23941454 |
| Molecular Formula | C20H18N4O8S2 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | [2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-hydroxy-5-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1cc(S(=O)(=O)N2CCCC2)ccc1O)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C20H18N4O8S2/c25-16-6-4-13(34(30,31)23-7-1-2-8-23)10-14(16)19(27)32-11-18(26)22-20-21-15-5-3-12(24(28)29)9-17(15)33-20/h3-6,9-10,25H,1-2,7-8,11H2,(H,21,22,26) |
| InChIKey | BTPBFMJPWORRMF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 169.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|