C24H17ClN4O7S2 — CID 23906595
[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 23906595) has the molecular formula C24H17ClN4O7S2 and a molecular weight of 573.01 g/mol. Its IUPAC name is [2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | [2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 23906595 |
| Molecular Formula | C24H17ClN4O7S2 |
| Molecular Weight | 573.01 g/mol |
| Exact Mass | 572.02 |
| IUPAC Name | [2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCc3ccccc32)c1)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C24H17ClN4O7S2/c25-17-7-5-15(11-21(17)38(34,35)28-10-9-14-3-1-2-4-19(14)28)23(31)36-13-22(30)27-24-26-18-8-6-16(29(32)33)12-20(18)37-24/h1-8,11-12H,9-10,13H2,(H,26,27,30) |
| InChIKey | CYHRPVMBTBIZPZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 148.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.01 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|