C20H20ClN3O7S — CID 2616621
[2-oxo-2-(4-piperidin-1-ylsulfonylanilino)ethyl] 2-chloro-4-nitrobenzoate (PubChem CID 2616621) has the molecular formula C20H20ClN3O7S and a molecular weight of 481.91 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylsulfonylanilino)ethyl] 2-chloro-4-nitrobenzoate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylsulfonylanilino)ethyl] 2-chloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 2616621 |
| Molecular Formula | C20H20ClN3O7S |
| Molecular Weight | 481.91 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylsulfonylanilino)ethyl] 2-chloro-4-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc([N+](=O)[O-])cc1Cl)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H20ClN3O7S/c21-18-12-15(24(27)28)6-9-17(18)20(26)31-13-19(25)22-14-4-7-16(8-5-14)32(29,30)23-10-2-1-3-11-23/h4-9,12H,1-3,10-11,13H2,(H,22,25) |
| InChIKey | SMFMHNCGKRUUPW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.91 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|