C14H16BrN3O3S2 — CID 4112345
2-bromo-N-(6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-yl)acetamide (PubChem CID 4112345) has the molecular formula C14H16BrN3O3S2 and a molecular weight of 418.34 g/mol. Its IUPAC name is 2-bromo-N-(6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-bromo-N-(6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4112345 |
| Molecular Formula | C14H16BrN3O3S2 |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | 2-bromo-N-(6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-yl)acetamide |
| SMILES | O=C(CBr)Nc1nc2ccc(S(=O)(=O)N3CCCCC3)cc2s1 |
| InChI | InChI=1S/C14H16BrN3O3S2/c15-9-13(19)17-14-16-11-5-4-10(8-12(11)22-14)23(20,21)18-6-2-1-3-7-18/h4-5,8H,1-3,6-7,9H2,(H,16,17,19) |
| InChIKey | GMUZGRISNTWBGM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|