C20H20BrN3O3S2 — CID 3345970
4-(bromomethyl)-N-(6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 3345970) has the molecular formula C20H20BrN3O3S2 and a molecular weight of 494.44 g/mol. Its IUPAC name is 4-(bromomethyl)-N-(6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-(bromomethyl)-N-(6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 3345970 |
| Molecular Formula | C20H20BrN3O3S2 |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 493.01 |
| IUPAC Name | 4-(bromomethyl)-N-(6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc2ccc(S(=O)(=O)N3CCCCC3)cc2s1)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C20H20BrN3O3S2/c21-13-14-4-6-15(7-5-14)19(25)23-20-22-17-9-8-16(12-18(17)28-20)29(26,27)24-10-2-1-3-11-24/h4-9,12H,1-3,10-11,13H2,(H,22,23,25) |
| InChIKey | GYUQBNQUMFANKY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|