C27H22N4O5S2 — CID 3464705
4-(1,3-dioxoisoindol-2-yl)-N-(6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 3464705) has the molecular formula C27H22N4O5S2 and a molecular weight of 546.63 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-(6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-(6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 3464705 |
| Molecular Formula | C27H22N4O5S2 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-(6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc2ccc(S(=O)(=O)N3CCCCC3)cc2s1)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C27H22N4O5S2/c32-24(17-8-10-18(11-9-17)31-25(33)20-6-2-3-7-21(20)26(31)34)29-27-28-22-13-12-19(16-23(22)37-27)38(35,36)30-14-4-1-5-15-30/h2-3,6-13,16H,1,4-5,14-15H2,(H,28,29,32) |
| InChIKey | BJIZUWDJBBAUQG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|