C21H28ClN3O2S — CID 108750890
4-(4-chlorophenoxy)-N-[4-methyl-5-[(4-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]butanamide (PubChem CID 108750890) has the molecular formula C21H28ClN3O2S and a molecular weight of 421.99 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-N-[4-methyl-5-[(4-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(4-chlorophenoxy)-N-[4-methyl-5-[(4-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 108750890 |
| Molecular Formula | C21H28ClN3O2S |
| Molecular Weight | 421.99 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 4-(4-chlorophenoxy)-N-[4-methyl-5-[(4-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]butanamide |
| SMILES | Cc1nc(NC(=O)CCCOc2ccc(Cl)cc2)sc1CN1CCC(C)CC1 |
| InChI | InChI=1S/C21H28ClN3O2S/c1-15-9-11-25(12-10-15)14-19-16(2)23-21(28-19)24-20(26)4-3-13-27-18-7-5-17(22)6-8-18/h5-8,15H,3-4,9-14H2,1-2H3,(H,23,24,26) |
| InChIKey | GXZDYNBZTIWGMS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.99 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|