C21H27N3OS — CID 108750838
(E)-N-[4-methyl-5-[(4-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 108750838) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is (E)-N-[4-methyl-5-[(4-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-methyl-5-[(4-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108750838 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (E)-N-[4-methyl-5-[(4-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2nc(C)c(CN3CCC(C)CC3)s2)cc1 |
| InChI | InChI=1S/C21H27N3OS/c1-15-4-6-18(7-5-15)8-9-20(25)23-21-22-17(3)19(26-21)14-24-12-10-16(2)11-13-24/h4-9,16H,10-14H2,1-3H3,(H,22,23,25)/b9-8+ |
| InChIKey | CFGKFKBFNJXDCJ-CMDGGOBGSA-N |
| XLogP | 4.64 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|