C12H18N2O3S — CID 82058784
3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid (PubChem CID 82058784) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid.
| Compound Name | 3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 82058784 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid |
| SMILES | CCCCC(=O)Nc1nc(C)c(CCC(=O)O)s1 |
| InChI | InChI=1S/C12H18N2O3S/c1-3-4-5-10(15)14-12-13-8(2)9(18-12)6-7-11(16)17/h3-7H2,1-2H3,(H,16,17)(H,13,14,15) |
| InChIKey | MORYYFLNUXMXEC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |