3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid

C12H18N2O3S — CID 82058784

IUPAC3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid
SMILESCCCCC(=O)Nc1nc(C)c(CCC(=O)O)s1
InChIInChI=1S/C12H18N2O3S/c1-3-4-5-10(15)14-12-13-8(2)9(18-12)6-7-11(16)17/h3-7H2,1-2H3,(H,16,17)(H,13,14,15)
InChIKeyMORYYFLNUXMXEC-UHFFFAOYSA-N
MW270.35 g/mol
LogP2.60
Rot. Bonds7

About 3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid

3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid (PubChem CID 82058784) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid.

Molecular Properties

Compound Name3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid
PubChem CID82058784
Molecular FormulaC12H18N2O3S
Molecular Weight270.35 g/mol
Exact Mass270.10
IUPAC Name3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid
SMILESCCCCC(=O)Nc1nc(C)c(CCC(=O)O)s1
InChIInChI=1S/C12H18N2O3S/c1-3-4-5-10(15)14-12-13-8(2)9(18-12)6-7-11(16)17/h3-7H2,1-2H3,(H,16,17)(H,13,14,15)
InChIKeyMORYYFLNUXMXEC-UHFFFAOYSA-N
XLogP2.60
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.35
LogP ≤ 52.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid?
The IUPAC name of 3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid (CID 82058784) is 3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid.
What is the SMILES notation for 3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid?
The canonical SMILES for 3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid is CCCCC(=O)Nc1nc(C)c(CCC(=O)O)s1.
What is the InChIKey of 3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid?
The InChIKey is MORYYFLNUXMXEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3S/c1-3-4-5-10(15)14-12-13-8(2)9(18-12)6-7-11(16)17/h3-7H2,1-2H3,(H,16,17)(H,13,14,15).
What are the key properties of 3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid?
3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid has a molecular weight of 270.35 g/mol, XLogP of 2.60, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-methyl-2-(pentanoylamino)-1,3-thiazol-5-yl]propanoic acid is sourced from PubChem (CID 82058784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).