C12H20N2OS — CID 110395064
N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]pentanamide (PubChem CID 110395064) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]pentanamide.
| Compound Name | N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 110395064 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]pentanamide |
| SMILES | CCCCC(=O)NCCc1sc(C)nc1C |
| InChI | InChI=1S/C12H20N2OS/c1-4-5-6-12(15)13-8-7-11-9(2)14-10(3)16-11/h4-8H2,1-3H3,(H,13,15) |
| InChIKey | DJDVXYRNODLTBU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |