C13H22N2OS — CID 110678864
3-(2,4-dimethyl-1,3-thiazol-5-yl)-N-pentylpropanamide (PubChem CID 110678864) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is 3-(2,4-dimethyl-1,3-thiazol-5-yl)-N-pentylpropanamide.
| Compound Name | 3-(2,4-dimethyl-1,3-thiazol-5-yl)-N-pentylpropanamide |
|---|---|
| PubChem CID | 110678864 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 3-(2,4-dimethyl-1,3-thiazol-5-yl)-N-pentylpropanamide |
| SMILES | CCCCCNC(=O)CCc1sc(C)nc1C |
| InChI | InChI=1S/C13H22N2OS/c1-4-5-6-9-14-13(16)8-7-12-10(2)15-11(3)17-12/h4-9H2,1-3H3,(H,14,16) |
| InChIKey | QAZQQBAZLAOXJF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|