C11H21ClN4O3 — CID 119384721
N-(2-aminoethyl)-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide;hydrochloride (PubChem CID 119384721) has the molecular formula C11H21ClN4O3 and a molecular weight of 292.77 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119384721 |
| Molecular Formula | C11H21ClN4O3 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | N-(2-aminoethyl)-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide;hydrochloride |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)NCCN)C1=O.Cl |
| InChI | InChI=1S/C11H20N4O3.ClH/c1-3-11(4-2)9(17)15(10(18)14-11)7-8(16)13-6-5-12;/h3-7,12H2,1-2H3,(H,13,16)(H,14,18);1H |
| InChIKey | GYDLSXQJCPMBRC-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|