C13H23ClN4O3 — CID 119384509
N-(2-aminoethyl)-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide;hydrochloride (PubChem CID 119384509) has the molecular formula C13H23ClN4O3 and a molecular weight of 318.81 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119384509 |
| Molecular Formula | C13H23ClN4O3 |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-(2-aminoethyl)-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide;hydrochloride |
| SMILES | CC1CCCCC12NC(=O)N(CC(=O)NCCN)C2=O.Cl |
| InChI | InChI=1S/C13H22N4O3.ClH/c1-9-4-2-3-5-13(9)11(19)17(12(20)16-13)8-10(18)15-7-6-14;/h9H,2-8,14H2,1H3,(H,15,18)(H,16,20);1H |
| InChIKey | XADNXESOENAOFY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|