C17H29N5O3 — CID 119447958
2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-piperazin-1-ylethyl)acetamide (PubChem CID 119447958) has the molecular formula C17H29N5O3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-piperazin-1-ylethyl)acetamide.
| Compound Name | 2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-piperazin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 119447958 |
| Molecular Formula | C17H29N5O3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(2-piperazin-1-ylethyl)acetamide |
| SMILES | CC1CCCCC12NC(=O)N(CC(=O)NCCN1CCNCC1)C2=O |
| InChI | InChI=1S/C17H29N5O3/c1-13-4-2-3-5-17(13)15(24)22(16(25)20-17)12-14(23)19-8-11-21-9-6-18-7-10-21/h13,18H,2-12H2,1H3,(H,19,23)(H,20,25) |
| InChIKey | TVOYTIAHMKPLND-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|