C15H27ClN4O3 — CID 119463484
2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(piperidin-3-ylmethyl)acetamide;hydrochloride (PubChem CID 119463484) has the molecular formula C15H27ClN4O3 and a molecular weight of 346.86 g/mol. Its IUPAC name is 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(piperidin-3-ylmethyl)acetamide;hydrochloride.
| Compound Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(piperidin-3-ylmethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119463484 |
| Molecular Formula | C15H27ClN4O3 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-(piperidin-3-ylmethyl)acetamide;hydrochloride |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)NCC2CCCNC2)C1=O.Cl |
| InChI | InChI=1S/C15H26N4O3.ClH/c1-3-15(4-2)13(21)19(14(22)18-15)10-12(20)17-9-11-6-5-7-16-8-11;/h11,16H,3-10H2,1-2H3,(H,17,20)(H,18,22);1H |
| InChIKey | OEUARZJTVPHEIU-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|