C14H25ClN4O3 — CID 119463240
2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-(piperidin-3-ylmethyl)acetamide;hydrochloride (PubChem CID 119463240) has the molecular formula C14H25ClN4O3 and a molecular weight of 332.83 g/mol. Its IUPAC name is 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-(piperidin-3-ylmethyl)acetamide;hydrochloride.
| Compound Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-(piperidin-3-ylmethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119463240 |
| Molecular Formula | C14H25ClN4O3 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-(piperidin-3-ylmethyl)acetamide;hydrochloride |
| SMILES | CCN1CCN(CC(=O)NCC2CCCNC2)C(=O)C1=O.Cl |
| InChI | InChI=1S/C14H24N4O3.ClH/c1-2-17-6-7-18(14(21)13(17)20)10-12(19)16-9-11-4-3-5-15-8-11;/h11,15H,2-10H2,1H3,(H,16,19);1H |
| InChIKey | FLUSKFQGAUZGTG-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|