C9H19ClN2OS — CID 119462298
2-methylsulfanyl-N-(piperidin-3-ylmethyl)acetamide;hydrochloride (PubChem CID 119462298) has the molecular formula C9H19ClN2OS and a molecular weight of 238.78 g/mol. Its IUPAC name is 2-methylsulfanyl-N-(piperidin-3-ylmethyl)acetamide;hydrochloride.
| Compound Name | 2-methylsulfanyl-N-(piperidin-3-ylmethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119462298 |
| Molecular Formula | C9H19ClN2OS |
| Molecular Weight | 238.78 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-methylsulfanyl-N-(piperidin-3-ylmethyl)acetamide;hydrochloride |
| SMILES | CSCC(=O)NCC1CCCNC1.Cl |
| InChI | InChI=1S/C9H18N2OS.ClH/c1-13-7-9(12)11-6-8-3-2-4-10-5-8;/h8,10H,2-7H2,1H3,(H,11,12);1H |
| InChIKey | VZFOBZYCUBIISK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.78 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |