C15H31ClN2O2 — CID 119464085
3-(4-methylpentan-2-yloxy)-N-(piperidin-3-ylmethyl)propanamide;hydrochloride (PubChem CID 119464085) has the molecular formula C15H31ClN2O2 and a molecular weight of 306.88 g/mol. Its IUPAC name is 3-(4-methylpentan-2-yloxy)-N-(piperidin-3-ylmethyl)propanamide;hydrochloride.
| Compound Name | 3-(4-methylpentan-2-yloxy)-N-(piperidin-3-ylmethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119464085 |
| Molecular Formula | C15H31ClN2O2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 3-(4-methylpentan-2-yloxy)-N-(piperidin-3-ylmethyl)propanamide;hydrochloride |
| SMILES | CC(C)CC(C)OCCC(=O)NCC1CCCNC1.Cl |
| InChI | InChI=1S/C15H30N2O2.ClH/c1-12(2)9-13(3)19-8-6-15(18)17-11-14-5-4-7-16-10-14;/h12-14,16H,4-11H2,1-3H3,(H,17,18);1H |
| InChIKey | ZHPITJCTXTVVJL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |