C14H28N2O2 — CID 119462657
2-(3-methylbutoxy)-N-(piperidin-3-ylmethyl)propanamide (PubChem CID 119462657) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-(3-methylbutoxy)-N-(piperidin-3-ylmethyl)propanamide.
| Compound Name | 2-(3-methylbutoxy)-N-(piperidin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 119462657 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 2-(3-methylbutoxy)-N-(piperidin-3-ylmethyl)propanamide |
| SMILES | CC(C)CCOC(C)C(=O)NCC1CCCNC1 |
| InChI | InChI=1S/C14H28N2O2/c1-11(2)6-8-18-12(3)14(17)16-10-13-5-4-7-15-9-13/h11-13,15H,4-10H2,1-3H3,(H,16,17) |
| InChIKey | WMPWTQIYHOWCOF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |