C13H22N2O3 — CID 18776959
3-(3,3-dimethyl-2-oxobutyl)-5,5-diethylimidazolidine-2,4-dione (PubChem CID 18776959) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-(3,3-dimethyl-2-oxobutyl)-5,5-diethylimidazolidine-2,4-dione.
| Compound Name | 3-(3,3-dimethyl-2-oxobutyl)-5,5-diethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18776959 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 3-(3,3-dimethyl-2-oxobutyl)-5,5-diethylimidazolidine-2,4-dione |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)C(C)(C)C)C1=O |
| InChI | InChI=1S/C13H22N2O3/c1-6-13(7-2)10(17)15(11(18)14-13)8-9(16)12(3,4)5/h6-8H2,1-5H3,(H,14,18) |
| InChIKey | MLILHWHIYJHGLH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|