C19H27N3O4S — CID 8522418
N-[[5-[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]thiophen-2-yl]methyl]-2,2-dimethylpropanamide (PubChem CID 8522418) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[[5-[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]thiophen-2-yl]methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[5-[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]thiophen-2-yl]methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 8522418 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[[5-[2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetyl]thiophen-2-yl]methyl]-2,2-dimethylpropanamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)c2ccc(CNC(=O)C(C)(C)C)s2)C1=O |
| InChI | InChI=1S/C19H27N3O4S/c1-6-19(7-2)16(25)22(17(26)21-19)11-13(23)14-9-8-12(27-14)10-20-15(24)18(3,4)5/h8-9H,6-7,10-11H2,1-5H3,(H,20,24)(H,21,26) |
| InChIKey | UHHAIECWMBHXHS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|