C17H31N3O3 — CID 84601319
2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N,N-bis(2-methylpropyl)acetamide (PubChem CID 84601319) has the molecular formula C17H31N3O3 and a molecular weight of 325.45 g/mol. Its IUPAC name is 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N,N-bis(2-methylpropyl)acetamide.
| Compound Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N,N-bis(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 84601319 |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N,N-bis(2-methylpropyl)acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)N(CC(C)C)CC(C)C)C1=O |
| InChI | InChI=1S/C17H31N3O3/c1-7-17(8-2)15(22)20(16(23)18-17)11-14(21)19(9-12(3)4)10-13(5)6/h12-13H,7-11H2,1-6H3,(H,18,23) |
| InChIKey | FNGSPUCEZWENRA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|