C21H31N3O3 — CID 2582395
2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N,N-bis(2-methylpropyl)acetamide (PubChem CID 2582395) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N,N-bis(2-methylpropyl)acetamide.
| Compound Name | 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N,N-bis(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 2582395 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N,N-bis(2-methylpropyl)acetamide |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(CC(=O)N(CC(C)C)CC(C)C)C1=O |
| InChI | InChI=1S/C21H31N3O3/c1-6-21(17-10-8-7-9-11-17)19(26)24(20(27)22-21)14-18(25)23(12-15(2)3)13-16(4)5/h7-11,15-16H,6,12-14H2,1-5H3,(H,22,27)/t21-/m1/s1 |
| InChIKey | ZOWVRAJLBBUVCL-OAQYLSRUSA-N |
| XLogP | 2.98 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|