C22H23N3O3 — CID 51215251
2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-phenyl-N-prop-2-enylacetamide (PubChem CID 51215251) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-phenyl-N-prop-2-enylacetamide.
| Compound Name | 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-phenyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 51215251 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-phenyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)CN1C(=O)NC(CC)(c2ccccc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O3/c1-3-15-24(18-13-9-6-10-14-18)19(26)16-25-20(27)22(4-2,23-21(25)28)17-11-7-5-8-12-17/h3,5-14H,1,4,15-16H2,2H3,(H,23,28) |
| InChIKey | ICPYARMDPHSMEH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|