C24H27N3O3 — CID 8625100
2-[(4S)-4-methyl-2,5-dioxo-4-(4-propan-2-ylphenyl)imidazolidin-1-yl]-N-phenyl-N-prop-2-enylacetamide (PubChem CID 8625100) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-[(4S)-4-methyl-2,5-dioxo-4-(4-propan-2-ylphenyl)imidazolidin-1-yl]-N-phenyl-N-prop-2-enylacetamide.
| Compound Name | 2-[(4S)-4-methyl-2,5-dioxo-4-(4-propan-2-ylphenyl)imidazolidin-1-yl]-N-phenyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 8625100 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 2-[(4S)-4-methyl-2,5-dioxo-4-(4-propan-2-ylphenyl)imidazolidin-1-yl]-N-phenyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)CN1C(=O)N[C@@](C)(c2ccc(C(C)C)cc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C24H27N3O3/c1-5-15-26(20-9-7-6-8-10-20)21(28)16-27-22(29)24(4,25-23(27)30)19-13-11-18(12-14-19)17(2)3/h5-14,17H,1,15-16H2,2-4H3,(H,25,30)/t24-/m0/s1 |
| InChIKey | ANQXPYVMGIRHAS-DEOSSOPVSA-N |
| XLogP | 3.80 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|