C27H29N3O3 — CID 46816705
N-ethyl-2-[4-methyl-2,5-dioxo-4-(4-propan-2-ylphenyl)imidazolidin-1-yl]-N-naphthalen-1-ylacetamide (PubChem CID 46816705) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-ethyl-2-[4-methyl-2,5-dioxo-4-(4-propan-2-ylphenyl)imidazolidin-1-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | N-ethyl-2-[4-methyl-2,5-dioxo-4-(4-propan-2-ylphenyl)imidazolidin-1-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 46816705 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-ethyl-2-[4-methyl-2,5-dioxo-4-(4-propan-2-ylphenyl)imidazolidin-1-yl]-N-naphthalen-1-ylacetamide |
| SMILES | CCN(C(=O)CN1C(=O)NC(C)(c2ccc(C(C)C)cc2)C1=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H29N3O3/c1-5-29(23-12-8-10-20-9-6-7-11-22(20)23)24(31)17-30-25(32)27(4,28-26(30)33)21-15-13-19(14-16-21)18(2)3/h6-16,18H,5,17H2,1-4H3,(H,28,33) |
| InChIKey | QSFBBXIHGKZGIY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|