C21H29N3O3 — CID 17402356
2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-methyl-N-(4-methylcyclohexyl)acetamide (PubChem CID 17402356) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-methyl-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-methyl-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 17402356 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-methyl-N-(4-methylcyclohexyl)acetamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)N(C)C2CCC(C)CC2)C1=O |
| InChI | InChI=1S/C21H29N3O3/c1-4-21(16-8-6-5-7-9-16)19(26)24(20(27)22-21)14-18(25)23(3)17-12-10-15(2)11-13-17/h5-9,15,17H,4,10-14H2,1-3H3,(H,22,27) |
| InChIKey | PIXYYDSVRLDAEK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|