C26H25N3O3 — CID 24565809
N-benzyl-2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-phenylacetamide (PubChem CID 24565809) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is N-benzyl-2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-phenylacetamide.
| Compound Name | N-benzyl-2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 24565809 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-benzyl-2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-phenylacetamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)N(Cc2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C26H25N3O3/c1-2-26(21-14-8-4-9-15-21)24(31)29(25(32)27-26)19-23(30)28(22-16-10-5-11-17-22)18-20-12-6-3-7-13-20/h3-17H,2,18-19H2,1H3,(H,27,32) |
| InChIKey | JWXUTESCNAYBSQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|