C23H26ClN3O3 — CID 2703107
N-benzyl-2-[(4R)-4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]-N-propan-2-ylacetamide (PubChem CID 2703107) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is N-benzyl-2-[(4R)-4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | N-benzyl-2-[(4R)-4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 2703107 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-benzyl-2-[(4R)-4-(4-chlorophenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]-N-propan-2-ylacetamide |
| SMILES | CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)N(Cc2ccccc2)C(C)C)C1=O |
| InChI | InChI=1S/C23H26ClN3O3/c1-4-23(18-10-12-19(24)13-11-18)21(29)27(22(30)25-23)15-20(28)26(16(2)3)14-17-8-6-5-7-9-17/h5-13,16H,4,14-15H2,1-3H3,(H,25,30)/t23-/m1/s1 |
| InChIKey | RDAIWWGDGGGYDC-HSZRJFAPSA-N |
| XLogP | 3.93 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|