C16H20N2O4 — CID 94752250
2-[(4R)-4-ethyl-2,5-dioxo-4-(4-propan-2-ylphenyl)imidazolidin-1-yl]acetic acid (PubChem CID 94752250) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[(4R)-4-ethyl-2,5-dioxo-4-(4-propan-2-ylphenyl)imidazolidin-1-yl]acetic acid.
| Compound Name | 2-[(4R)-4-ethyl-2,5-dioxo-4-(4-propan-2-ylphenyl)imidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 94752250 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-[(4R)-4-ethyl-2,5-dioxo-4-(4-propan-2-ylphenyl)imidazolidin-1-yl]acetic acid |
| SMILES | CC[C@]1(c2ccc(C(C)C)cc2)NC(=O)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C16H20N2O4/c1-4-16(12-7-5-11(6-8-12)10(2)3)14(21)18(9-13(19)20)15(22)17-16/h5-8,10H,4,9H2,1-3H3,(H,17,22)(H,19,20)/t16-/m1/s1 |
| InChIKey | LDRSYGNBBCBDKT-MRXNPFEDSA-N |
| XLogP | 2.05 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|