C16H20N2O5 — CID 75532094
2-[4-ethyl-2,5-dioxo-4-(4-propan-2-yloxyphenyl)imidazolidin-1-yl]acetic acid (PubChem CID 75532094) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-[4-ethyl-2,5-dioxo-4-(4-propan-2-yloxyphenyl)imidazolidin-1-yl]acetic acid.
| Compound Name | 2-[4-ethyl-2,5-dioxo-4-(4-propan-2-yloxyphenyl)imidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 75532094 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-[4-ethyl-2,5-dioxo-4-(4-propan-2-yloxyphenyl)imidazolidin-1-yl]acetic acid |
| SMILES | CCC1(c2ccc(OC(C)C)cc2)NC(=O)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C16H20N2O5/c1-4-16(11-5-7-12(8-6-11)23-10(2)3)14(21)18(9-13(19)20)15(22)17-16/h5-8,10H,4,9H2,1-3H3,(H,17,22)(H,19,20) |
| InChIKey | TYBWWICGISYOPB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|