C23H24FN3O5 — CID 55355208
ethyl 2-(N-[2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]anilino)acetate (PubChem CID 55355208) has the molecular formula C23H24FN3O5 and a molecular weight of 441.46 g/mol. Its IUPAC name is ethyl 2-(N-[2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]anilino)acetate.
| Compound Name | ethyl 2-(N-[2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]anilino)acetate |
|---|---|
| PubChem CID | 55355208 |
| Molecular Formula | C23H24FN3O5 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | ethyl 2-(N-[2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]anilino)acetate |
| SMILES | CCOC(=O)CN(C(=O)CN1C(=O)NC(CC)(c2ccc(F)cc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C23H24FN3O5/c1-3-23(16-10-12-17(24)13-11-16)21(30)27(22(31)25-23)14-19(28)26(15-20(29)32-4-2)18-8-6-5-7-9-18/h5-13H,3-4,14-15H2,1-2H3,(H,25,31) |
| InChIKey | CCIYVBBWZUGOPB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|