C22H20F2N4O3 — CID 46582965
N-(2-cyanoethyl)-2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 46582965) has the molecular formula C22H20F2N4O3 and a molecular weight of 426.42 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 46582965 |
| Molecular Formula | C22H20F2N4O3 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-(2-cyanoethyl)-2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | CCC1(c2ccc(F)cc2)NC(=O)N(CC(=O)N(CCC#N)c2ccccc2F)C1=O |
| InChI | InChI=1S/C22H20F2N4O3/c1-2-22(15-8-10-16(23)11-9-15)20(30)28(21(31)26-22)14-19(29)27(13-5-12-25)18-7-4-3-6-17(18)24/h3-4,6-11H,2,5,13-14H2,1H3,(H,26,31) |
| InChIKey | USNKCJCKFJTPIG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|