C17H21FN2O4 — CID 4680291
tert-butyl 2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 4680291) has the molecular formula C17H21FN2O4 and a molecular weight of 336.36 g/mol. Its IUPAC name is tert-butyl 2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 4680291 |
| Molecular Formula | C17H21FN2O4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | tert-butyl 2-[4-ethyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CCC1(c2ccc(F)cc2)NC(=O)N(CC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C17H21FN2O4/c1-5-17(11-6-8-12(18)9-7-11)14(22)20(15(23)19-17)10-13(21)24-16(2,3)4/h6-9H,5,10H2,1-4H3,(H,19,23) |
| InChIKey | KUZWTHHODWGVEL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|