C23H25N3O5 — CID 55355319
ethyl 2-(N-[2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]anilino)acetate (PubChem CID 55355319) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is ethyl 2-(N-[2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]anilino)acetate.
| Compound Name | ethyl 2-(N-[2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]anilino)acetate |
|---|---|
| PubChem CID | 55355319 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | ethyl 2-(N-[2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]anilino)acetate |
| SMILES | CCOC(=O)CN(C(=O)CN1C(=O)NC(C)(c2ccc(C)cc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C23H25N3O5/c1-4-31-20(28)15-25(18-8-6-5-7-9-18)19(27)14-26-21(29)23(3,24-22(26)30)17-12-10-16(2)11-13-17/h5-13H,4,14-15H2,1-3H3,(H,24,30) |
| InChIKey | DBSOGNBGIJMUKO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|