C28H30N4O3 — CID 40781626
N-(4-anilinophenyl)-2-[(4R)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-propan-2-ylacetamide (PubChem CID 40781626) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-[(4R)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | N-(4-anilinophenyl)-2-[(4R)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 40781626 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | N-(4-anilinophenyl)-2-[(4R)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-propan-2-ylacetamide |
| SMILES | Cc1ccc([C@@]2(C)NC(=O)N(CC(=O)N(c3ccc(Nc4ccccc4)cc3)C(C)C)C2=O)cc1 |
| InChI | InChI=1S/C28H30N4O3/c1-19(2)32(24-16-14-23(15-17-24)29-22-8-6-5-7-9-22)25(33)18-31-26(34)28(4,30-27(31)35)21-12-10-20(3)11-13-21/h5-17,19,29H,18H2,1-4H3,(H,30,35)/t28-/m1/s1 |
| InChIKey | ABDRGFOVWITSNK-MUUNZHRXSA-N |
| XLogP | 4.95 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|