C19H23N3O5 — CID 122067032
2-[cyclopropyl-[2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]propanoic acid (PubChem CID 122067032) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-[cyclopropyl-[2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]propanoic acid.
| Compound Name | 2-[cyclopropyl-[2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122067032 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-[cyclopropyl-[2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]propanoic acid |
| SMILES | Cc1ccc(C2(C)NC(=O)N(CC(=O)N(C3CC3)C(C)C(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C19H23N3O5/c1-11-4-6-13(7-5-11)19(3)17(26)21(18(27)20-19)10-15(23)22(14-8-9-14)12(2)16(24)25/h4-7,12,14H,8-10H2,1-3H3,(H,20,27)(H,24,25) |
| InChIKey | CSKCVVUVCIREOZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|