C22H23N3O5 — CID 47093930
[2-(N-ethylanilino)-2-oxoethyl] 2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate (PubChem CID 47093930) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is [2-(N-ethylanilino)-2-oxoethyl] 2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate.
| Compound Name | [2-(N-ethylanilino)-2-oxoethyl] 2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 47093930 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | [2-(N-ethylanilino)-2-oxoethyl] 2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate |
| SMILES | CCN(C(=O)COC(=O)CN1C(=O)NC(C)(c2ccccc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O5/c1-3-24(17-12-8-5-9-13-17)18(26)15-30-19(27)14-25-20(28)22(2,23-21(25)29)16-10-6-4-7-11-16/h4-13H,3,14-15H2,1-2H3,(H,23,29) |
| InChIKey | BLQWSBURDFDNKX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|