C17H27N3O3 — CID 51077613
N-cyclopentyl-N-cyclopropyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 51077613) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-cyclopentyl-N-cyclopropyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-cyclopentyl-N-cyclopropyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 51077613 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | N-cyclopentyl-N-cyclopropyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)N(C2CCCC2)C2CC2)C1=O |
| InChI | InChI=1S/C17H27N3O3/c1-3-17(4-2)15(22)19(16(23)18-17)11-14(21)20(13-9-10-13)12-7-5-6-8-12/h12-13H,3-11H2,1-2H3,(H,18,23) |
| InChIKey | QAQXXQJGTUMAPP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|