C19H31N3O5 — CID 11913583
[2-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 11913583) has the molecular formula C19H31N3O5 and a molecular weight of 381.47 g/mol. Its IUPAC name is [2-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 11913583 |
| Molecular Formula | C19H31N3O5 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | [2-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)OCC(=O)N[C@@H]2CCC[C@H](C)[C@@H]2C)C1=O |
| InChI | InChI=1S/C19H31N3O5/c1-5-19(6-2)17(25)22(18(26)21-19)10-16(24)27-11-15(23)20-14-9-7-8-12(3)13(14)4/h12-14H,5-11H2,1-4H3,(H,20,23)(H,21,26)/t12-,13-,14+/m0/s1 |
| InChIKey | ZNLNHQIPLARVOR-MELADBBJSA-N |
| XLogP | 1.58 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|