C18H29N3O5 — CID 7617533
[2-(cyclopentylamino)-2-oxoethyl] 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate (PubChem CID 7617533) has the molecular formula C18H29N3O5 and a molecular weight of 367.45 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 7617533 |
| Molecular Formula | C18H29N3O5 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate |
| SMILES | CCCC1(CCC)NC(=O)N(CC(=O)OCC(=O)NC2CCCC2)C1=O |
| InChI | InChI=1S/C18H29N3O5/c1-3-9-18(10-4-2)16(24)21(17(25)20-18)11-15(23)26-12-14(22)19-13-7-5-6-8-13/h13H,3-12H2,1-2H3,(H,19,22)(H,20,25) |
| InChIKey | FKTFYVOMUDYPTD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|