C18H24N2O4 — CID 7617485
benzyl 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate (PubChem CID 7617485) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is benzyl 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate.
| Compound Name | benzyl 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 7617485 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | benzyl 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate |
| SMILES | CCCC1(CCC)NC(=O)N(CC(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C18H24N2O4/c1-3-10-18(11-4-2)16(22)20(17(23)19-18)12-15(21)24-13-14-8-6-5-7-9-14/h5-9H,3-4,10-13H2,1-2H3,(H,19,23) |
| InChIKey | PCYFWNUTUOCOKG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|