C16H22N4O5 — CID 9476496
N'-[2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetyl]furan-2-carbohydrazide (PubChem CID 9476496) has the molecular formula C16H22N4O5 and a molecular weight of 350.38 g/mol. Its IUPAC name is N'-[2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 9476496 |
| Molecular Formula | C16H22N4O5 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N'-[2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetyl]furan-2-carbohydrazide |
| SMILES | CCCC1(CCC)NC(=O)N(CC(=O)NNC(=O)c2ccco2)C1=O |
| InChI | InChI=1S/C16H22N4O5/c1-3-7-16(8-4-2)14(23)20(15(24)17-16)10-12(21)18-19-13(22)11-6-5-9-25-11/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,17,24)(H,18,21)(H,19,22) |
| InChIKey | BVCDWXDOZIICDS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|