C21H19F3N2O4 — CID 55445207
[4-(trifluoromethyl)phenyl]methyl 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate (PubChem CID 55445207) has the molecular formula C21H19F3N2O4 and a molecular weight of 420.39 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]methyl 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate.
| Compound Name | [4-(trifluoromethyl)phenyl]methyl 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 55445207 |
| Molecular Formula | C21H19F3N2O4 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]methyl 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)OCc2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C21H19F3N2O4/c1-2-20(15-6-4-3-5-7-15)18(28)26(19(29)25-20)12-17(27)30-13-14-8-10-16(11-9-14)21(22,23)24/h3-11H,2,12-13H2,1H3,(H,25,29) |
| InChIKey | AGOPWYDGWFXTTN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|