C22H24N4O4 — CID 24978772
4-ethyl-N'-[2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]benzohydrazide (PubChem CID 24978772) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 4-ethyl-N'-[2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]benzohydrazide.
| Compound Name | 4-ethyl-N'-[2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 24978772 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 4-ethyl-N'-[2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]benzohydrazide |
| SMILES | CCc1ccc(C(=O)NNC(=O)CN2C(=O)NC(CC)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C22H24N4O4/c1-3-15-10-12-16(13-11-15)19(28)25-24-18(27)14-26-20(29)22(4-2,23-21(26)30)17-8-6-5-7-9-17/h5-13H,3-4,14H2,1-2H3,(H,23,30)(H,24,27)(H,25,28) |
| InChIKey | RDCPDCPZPOHQAD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|