C23H27N5O4 — CID 36766061
4-(diethylamino)-N'-[2-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]benzohydrazide (PubChem CID 36766061) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 4-(diethylamino)-N'-[2-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]benzohydrazide.
| Compound Name | 4-(diethylamino)-N'-[2-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 36766061 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 4-(diethylamino)-N'-[2-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]benzohydrazide |
| SMILES | CCN(CC)c1ccc(C(=O)NNC(=O)CN2C(=O)N[C@@](C)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C23H27N5O4/c1-4-27(5-2)18-13-11-16(12-14-18)20(30)26-25-19(29)15-28-21(31)23(3,24-22(28)32)17-9-7-6-8-10-17/h6-14H,4-5,15H2,1-3H3,(H,24,32)(H,25,29)(H,26,30)/t23-/m0/s1 |
| InChIKey | NHXDSAAVQXSEDS-QHCPKHFHSA-N |
| XLogP | 1.76 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|